EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O7S |
| Net Charge | 0 |
| Average Mass | 447.469 |
| Monoisotopic Mass | 447.11002 |
| SMILES | CCOC(=O)c1ccc(C(=O)OCC)c(NC(=S)Nc2ccc([N+](=O)[O-])cc2OC)c1 |
| InChI | InChI=1S/C20H21N3O7S/c1-4-29-18(24)12-6-8-14(19(25)30-5-2)16(10-12)22-20(31)21-15-9-7-13(23(26)27)11-17(15)28-3/h6-11H,4-5H2,1-3H3,(H2,21,22,31) |
| InChIKey | BHYAPMHXMSCJNS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[(2-methoxy-4-nitroanilino)-sulfanylidenemethyl]amino]benzene-1,4-dicarboxylic acid diethyl ester (CHEBI:114546) is a phthalate ester (CHEBI:35484) |
| Manual Xrefs | Databases |
|---|---|
| LSM-26007 | LINCS |