EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28BrN3O3 |
| Net Charge | 0 |
| Average Mass | 450.377 |
| Monoisotopic Mass | 449.13140 |
| SMILES | CCOC(=O)c1nc2ccc(Br)cc2c1NC(=O)CCN1CCCC(C)(C)C1 |
| InChI | InChI=1S/C21H28BrN3O3/c1-4-28-20(27)19-18(15-12-14(22)6-7-16(15)23-19)24-17(26)8-11-25-10-5-9-21(2,3)13-25/h6-7,12,23H,4-5,8-11,13H2,1-3H3,(H,24,26) |
| InChIKey | AOWDMULDHNLFER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-bromo-3-[[3-(3,3-dimethyl-1-piperidinyl)-1-oxopropyl]amino]-1H-indole-2-carboxylic acid ethyl ester (CHEBI:114270) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-25730 | LINCS |