EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23NO3 |
| Net Charge | 0 |
| Average Mass | 337.419 |
| Monoisotopic Mass | 337.16779 |
| SMILES | CCCCCc1ccc(C=CC(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-2-3-4-7-16-10-12-17(13-11-16)14-15-20(23)22-19-9-6-5-8-18(19)21(24)25/h5-6,8-15H,2-4,7H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | GAMRBCZMOOMBSQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[1-oxo-3-(4-pentylphenyl)prop-2-enyl]amino]benzoic acid (CHEBI:114200) has functional parent anthranilic acid (CHEBI:30754) |
| 2-[[1-oxo-3-(4-pentylphenyl)prop-2-enyl]amino]benzoic acid (CHEBI:114200) is a amidobenzoic acid (CHEBI:48470) |
| 2-[[1-oxo-3-(4-pentylphenyl)prop-2-enyl]amino]benzoic acid (CHEBI:114200) is a cinnamamides (CHEBI:23247) |
| 2-[[1-oxo-3-(4-pentylphenyl)prop-2-enyl]amino]benzoic acid (CHEBI:114200) is a secondary carboxamide (CHEBI:140325) |
| Manual Xrefs | Databases |
|---|---|
| LSM-25657 | LINCS |