EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11NO2 |
| Net Charge | 0 |
| Average Mass | 249.269 |
| Monoisotopic Mass | 249.07898 |
| SMILES | O=C(O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C16H11NO2/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H,(H,18,19) |
| InChIKey | YTRMTPPVNRALON-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-phenyl-4-quinolinecarboxylic acid (CHEBI:114195) has role gout suppressant (CHEBI:35845) |
| 2-phenyl-4-quinolinecarboxylic acid (CHEBI:114195) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| cincofeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| aciphenochinoline | DrugCentral |
| aciphenochinolinium | DrugCentral |
| cincain | DrugCentral |
| cinchophen | ChEMBL |
| Cinchophen | ChEMBL |
| cinchophene | DrugCentral |
| Citations |
|---|