EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35N3O6 |
| Net Charge | 0 |
| Average Mass | 509.603 |
| Monoisotopic Mass | 509.25259 |
| SMILES | C[C@@H]1CN([C@@H](C)CO)C(=O)c2cccc(NC(=O)C3CC3)c2O[C@H]1CN(C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H35N3O6/c1-17-13-31(18(2)16-32)27(34)22-5-4-6-23(29-26(33)20-11-12-20)25(22)37-24(17)15-30(3)14-19-7-9-21(10-8-19)28(35)36/h4-10,17-18,20,24,32H,11-16H2,1-3H3,(H,29,33)(H,35,36)/t17-,18+,24+/m1/s1 |
| InChIKey | JIVQHRCMRGEILI-YTZAWJCFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[[(2R,3R)-10-[[cyclopropyl(oxo)methyl]amino]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-1,5-benzoxazocin-2-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:113752) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-25184 | LINCS |