EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | CC1=CC(=O)C(C(C)C)=CC1=O |
| InChI | InChI=1S/C10H12O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6H,1-3H3 |
| InChIKey | KEQHJBNSCLWCAE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nigella sativa (ncbitaxon:555479) | - | PubMed (32074066) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thymoquinone (CHEBI:113532) has role adjuvant (CHEBI:60809) |
| thymoquinone (CHEBI:113532) has role anti-inflammatory agent (CHEBI:67079) |
| thymoquinone (CHEBI:113532) has role antidepressant (CHEBI:35469) |
| thymoquinone (CHEBI:113532) has role antineoplastic agent (CHEBI:35610) |
| thymoquinone (CHEBI:113532) has role antioxidant (CHEBI:22586) |
| thymoquinone (CHEBI:113532) has role cardioprotective agent (CHEBI:77307) |
| thymoquinone (CHEBI:113532) has role plant metabolite (CHEBI:76924) |
| thymoquinone (CHEBI:113532) is a 1,4-benzoquinones (CHEBI:132124) |
| IUPAC Name |
|---|
| 2-methyl-5-(propan-2-yl)cyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-isopropyl-5-methyl-1,4-benzoquinone | ChEBI |
| 2-isopropyl-5-methyl-p-benzoquinone | ChemIDplus |
| 2-methyl-5-(1-methylethyl)-2,5-cyclohexadiene-1,4-dione | ChemIDplus |
| 5-isopropyl-2-methyl-2,5-cyclohexadiene-1,4-dione | ChemIDplus |
| p-cymene-2,5-dione | ChemIDplus |
| p-mentha-3,6-diene-2,5-dione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00010876 | KNApSAcK |
| FDB013274 | FooDB |
| HMDB0034732 | HMDB |
| IMW | PDBeChem |
| LSM-24947 | LINCS |
| Thymoquinone | Wikipedia |
| Citations |
|---|