EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:113455 - sodium benzoate
| Formula | C7H5O2.Na |
| Net Charge | 0 |
| Average Mass | 144.105 |
| Monoisotopic Mass | 144.01872 |
| SMILES | O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1 |
| InChIKey | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Piper sarmentosum (ncbitaxon:405319) | twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) |
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried,powdered leaves,p-anisic & benzoic acid mixture |
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Marine derived fungus isolated from sponge Callyspongia sp. cf. C. flammea Strain: 220 |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 15-lipoxygenase (EC 1.13.11.33). antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). drug allergen Any drug which causes the onset of an allergic reaction. EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium benzoate (CHEBI:113455) has part benzoate (CHEBI:16150) |
| sodium benzoate (CHEBI:113455) has role algal metabolite (CHEBI:84735) |
| sodium benzoate (CHEBI:113455) has role antimicrobial food preservative (CHEBI:65256) |
| sodium benzoate (CHEBI:113455) has role drug allergen (CHEBI:88188) |
| sodium benzoate (CHEBI:113455) has role EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor (CHEBI:64996) |
| sodium benzoate (CHEBI:113455) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| sodium benzoate (CHEBI:113455) has role human xenobiotic metabolite (CHEBI:76967) |
| sodium benzoate (CHEBI:113455) has role plant metabolite (CHEBI:76924) |
| sodium benzoate (CHEBI:113455) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| sodium caffeine benzoate (CHEBI:32140) has part sodium benzoate (CHEBI:113455) |
| IUPAC Name |
|---|
| sodium benzoate |
| Synonyms | Source |
|---|---|
| Benzoic acid, sodium salt | ChemIDplus |
| E211 | ChEBI |
| Brand Name | Source |
|---|---|
| Sodium benzoate | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02277 | KEGG DRUG |
| Sodium_benzoate | Wikipedia |
| Citations |
|---|