EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5O2.Na |
| Net Charge | 0 |
| Average Mass | 144.105 |
| Monoisotopic Mass | 144.01872 |
| SMILES | O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1 |
| InChIKey | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Piper sarmentosum (ncbitaxon:405319) | twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) |
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried,powdered leaves,p-anisic & benzoic acid mixture |
| Stachylidium (ncbitaxon:796327) | - | PubMed (21162532) | Marine derived fungus isolated from sponge Callyspongia sp. cf. C. flammea Strain: 220 |
| Roles Classification |
|---|
| Chemical Role: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Biological Roles: | EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 15-lipoxygenase (EC 1.13.11.33). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium benzoate (CHEBI:113455) has part benzoate (CHEBI:16150) |
| sodium benzoate (CHEBI:113455) has role algal metabolite (CHEBI:84735) |
| sodium benzoate (CHEBI:113455) has role antimicrobial food preservative (CHEBI:65256) |
| sodium benzoate (CHEBI:113455) has role antipsychotic agent (CHEBI:35476) |
| sodium benzoate (CHEBI:113455) has role drug allergen (CHEBI:88188) |
| sodium benzoate (CHEBI:113455) has role EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor (CHEBI:64996) |
| sodium benzoate (CHEBI:113455) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| sodium benzoate (CHEBI:113455) has role human xenobiotic metabolite (CHEBI:76967) |
| sodium benzoate (CHEBI:113455) has role plant metabolite (CHEBI:76924) |
| sodium benzoate (CHEBI:113455) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| sodium caffeine benzoate (CHEBI:32140) has part sodium benzoate (CHEBI:113455) |
| IUPAC Name |
|---|
| sodium benzoate |
| Synonyms | Source |
|---|---|
| Antimol | ChEMBL |
| Benzoic acid, sodium salt | ChemIDplus |
| E-211 | ChEMBL |
| E211 | ChEBI |
| FEMA NO. 3025 | ChEMBL |
| Fuminaru | ChEMBL |
| Brand Names | Source |
|---|---|
| Amzoate | ChEMBL |
| Mthwsh | ChEMBL |
| Sodium benzoate | KEGG DRUG |
| Sodium benzoate component of ammonul | ChEMBL |
| Sodium benzoate component of ucephan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D02277 | KEGG DRUG |
| Sodium_benzoate | Wikipedia |
| Citations |
|---|