EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9Cl2NO5S |
| Net Charge | 0 |
| Average Mass | 350.179 |
| Monoisotopic Mass | 348.95785 |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCc2ccco2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2NO5S/c13-9-5-10(14)11(4-8(9)12(16)17)21(18,19)15-6-7-2-1-3-20-7/h1-5,15H,6H2,(H,16,17) |
| InChIKey | LTLCPKPWNLFQRV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichloro-5-(2-furanylmethylsulfamoyl)benzoic acid (CHEBI:113258) is a chlorobenzoic acid (CHEBI:23134) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24669 | LINCS |