EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H13Cl2F3N4O4 |
| Net Charge | 0 |
| Average Mass | 513.259 |
| Monoisotopic Mass | 512.02659 |
| SMILES | O=C(NC1(C(F)(F)F)C(=O)Nc2c1c(=O)nc(=O)n2Cc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H13Cl2F3N4O4/c22-11-6-7-12(13(23)8-11)16(31)29-20(21(24,25)26)14-15(27-18(20)33)30(19(34)28-17(14)32)9-10-4-2-1-3-5-10/h1-8H,9H2,(H,27,33)(H,29,31)(H,28,32,34) |
| InChIKey | OHLMTMVIJJPTHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichloro-N-[2,4,6-trioxo-1-(phenylmethyl)-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzamide (CHEBI:113219) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24630 | LINCS |