EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N2O2 |
| Net Charge | 0 |
| Average Mass | 202.213 |
| Monoisotopic Mass | 202.07423 |
| SMILES | Nc1ccc(C(=O)Nc2ccco2)cc1 |
| InChI | InChI=1S/C11H10N2O2/c12-9-5-3-8(4-6-9)11(14)13-10-2-1-7-15-10/h1-7H,12H2,(H,13,14) |
| InChIKey | OPUZLTHGCQFFAG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-N-(2-furanyl)benzamide (CHEBI:113218) is a aminobenzoic acid (CHEBI:22495) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24629 | LINCS |