EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:90886 - 2-hydroxy-6-oxo-2,4-heptadienoic acid
| Formula | C7H8O4 |
| Net Charge | 0 |
| Average Mass | 156.137 |
| Monoisotopic Mass | 156.04226 |
| SMILES | CC(=O)C=CC=C(O)C(=O)O |
| InChI | InChI=1S/C7H8O4/c1-5(8)3-2-4-6(9)7(10)11/h2-4,9H,1H3,(H,10,11) |
| InChIKey | HVZGWILTESYJSP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (16347440) | Strain: T2 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) is a enone (CHEBI:51689) |
| 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) is a oxo monocarboxylic acid (CHEBI:35871) |
| 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) is conjugate acid of 2-hydroxy-6-oxo-2,4-heptadienoate (CHEBI:90887) |
| Incoming Relation(s) |
| (2Z,4E)-2-hydroxy-6-oxohepta-2,4-dienoic acid (CHEBI:144513) is a 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) |
| 2-hydroxy-6-oxo-2,4-heptadienoate (CHEBI:90887) is conjugate base of 2-hydroxy-6-oxo-2,4-heptadienoic acid (CHEBI:90886) |
| Synonyms | Source |
|---|---|
| 2-hydroxy-6-keto-2,4 heptadienoic acid | ChEBI |
| 2-hydroxy-6-oxohepta-2,4-dienoic acid | ChEBI |
| Citations |
|---|