EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2O6 |
| Net Charge | 0 |
| Average Mass | 380.356 |
| Monoisotopic Mass | 380.10084 |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)OCC(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H16N2O6/c21-8-7-19(24)22-15-4-1-13(2-5-15)20(25)28-12-16(23)14-3-6-17-18(11-14)27-10-9-26-17/h1-6,11H,7,9-10,12H2,(H,22,24) |
| InChIKey | JJEUNASOOJLQCS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(2-cyano-1-oxoethyl)amino]benzoic acid [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] ester (CHEBI:113110) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24520 | LINCS |