EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO3S |
| Net Charge | 0 |
| Average Mass | 289.356 |
| Monoisotopic Mass | 289.07726 |
| SMILES | COC(=O)c1ccsc1NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C15H15NO3S/c1-19-15(18)12-9-10-20-14(12)16-13(17)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,16,17) |
| InChIKey | MTQVMVKSXBFESI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(1-oxo-3-phenylpropyl)amino]-3-thiophenecarboxylic acid methyl ester (CHEBI:113098) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24508 | LINCS |