EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24N2O5S |
| Net Charge | 0 |
| Average Mass | 524.598 |
| Monoisotopic Mass | 524.14059 |
| SMILES | COc1ccccc1C1C2=C(N=c3sc(=Cc4cccc(OCC(=O)O)c4)c(=O)n31)c1ccccc1CC2 |
| InChI | InChI=1S/C30H24N2O5S/c1-36-24-12-5-4-11-22(24)28-23-14-13-19-8-2-3-10-21(19)27(23)31-30-32(28)29(35)25(38-30)16-18-7-6-9-20(15-18)37-17-26(33)34/h2-12,15-16,28H,13-14,17H2,1H3,(H,33,34) |
| InChIKey | XCPQKGPAGJNOBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-24476 (CHEBI:113066) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24476 | LINCS |