EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | C[C@@H]1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C10H13NO2/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6/h4-6,11-13H,2-3H2,1H3/t6-/m0/s1 |
| InChIKey | IBRKLUSXDYATLG-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | Urine (NCIT:C13283) | PubMed (8651468) |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-salsolinol (CHEBI:113) has role human urinary metabolite (CHEBI:84087) |
| (S)-salsolinol (CHEBI:113) is a 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol (CHEBI:194221) |
| (S)-salsolinol (CHEBI:113) is enantiomer of (R)-salsolinol (CHEBI:88801) |
| Incoming Relation(s) |
| (S)-N-Methylsalsolinol (CHEBI:88540) has functional parent (S)-salsolinol (CHEBI:113) |
| salsolinol (CHEBI:194220) has part (S)-salsolinol (CHEBI:113) |
| (R)-salsolinol (CHEBI:88801) is enantiomer of (S)-salsolinol (CHEBI:113) |
| IUPAC Name |
|---|
| (1S)-1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Synonyms | Source |
|---|---|
| (−)-salsolinol | KNApSAcK |
| (S)-1,2,3,4-tetrahydro-1-methyl-6,7-isoquinolinediol | KEGG COMPOUND |
| (−)-(S)-salsolinol | ChEBI |
| (S)-(−)-salsolinol | ChEBI |
| (S)-SAL | ChEBI |
| (S)-1-methyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:27740-96-1 | ChemIDplus |
| Citations |
|---|