EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10F3NOS2 |
| Net Charge | 0 |
| Average Mass | 317.357 |
| Monoisotopic Mass | 317.01559 |
| SMILES | Cc1ccc(SC(=O)c2sc(C)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H10F3NOS2/c1-7-3-5-9(6-4-7)20-12(18)10-11(13(14,15)16)17-8(2)19-10/h3-6H,1-2H3 |
| InChIKey | YSFAXDHDPRZXTB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-4-(trifluoromethyl)-5-thiazolecarbothioic acid S-(4-methylphenyl) ester (CHEBI:112853) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-methyl-4-(trifluoromethyl)-5-thiazolecarbothioic acid S-(4-methylphenyl) ester (CHEBI:112853) is a thiazoles (CHEBI:48901) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24263 | LINCS |