EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15ClN2O2S |
| Net Charge | 0 |
| Average Mass | 346.839 |
| Monoisotopic Mass | 346.05428 |
| SMILES | O=C(NC1=NCCS1)c1ccccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C17H15ClN2O2S/c18-14-7-3-1-5-12(14)11-22-15-8-4-2-6-13(15)16(21)20-17-19-9-10-23-17/h1-8H,9-11H2,(H,19,20,21) |
| InChIKey | OEVSYCFZIAVZAY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(2-chlorophenyl)methoxy]-N-(4,5-dihydrothiazol-2-yl)benzamide (CHEBI:112788) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24198 | LINCS |