EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O4 |
| Net Charge | 0 |
| Average Mass | 315.329 |
| Monoisotopic Mass | 315.12191 |
| SMILES | COc1ccc(C(=O)NNC=C2C(=O)C(C)=NC=C2CO)cc1 |
| InChI | InChI=1S/C16H17N3O4/c1-10-15(21)14(12(9-20)7-17-10)8-18-19-16(22)11-3-5-13(23-2)6-4-11/h3-8,18,20H,9H2,1-2H3,(H,19,22) |
| InChIKey | WUISSPDJBPMDGE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'-[[5-(hydroxymethyl)-2-methyl-3-oxo-4-pyridinylidene]methyl]-4-methoxybenzohydrazide (CHEBI:112724) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-24134 | LINCS |