EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2O6 |
| Net Charge | 0 |
| Average Mass | 380.356 |
| Monoisotopic Mass | 380.10084 |
| SMILES | COc1cc(C=Cc2ccc3cccc([N+](=O)[O-])c3n2)ccc1OCC(=O)O |
| InChI | InChI=1S/C20H16N2O6/c1-27-18-11-13(6-10-17(18)28-12-19(23)24)5-8-15-9-7-14-3-2-4-16(22(25)26)20(14)21-15/h2-11H,12H2,1H3,(H,23,24) |
| InChIKey | PTOFYNLLKNLRKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[2-methoxy-4-[2-(8-nitro-2-quinolinyl)ethenyl]phenoxy]acetic acid (CHEBI:112451) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23863 | LINCS |