EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:112441 - 5-[2-(2,6-dioxocyclohexylidene)hydrazinyl]-3-methylthiophene-2,4-dicarboxylic acid diethyl ester
| Formula | C17H20N2O6S |
| Net Charge | 0 |
| Average Mass | 380.422 |
| Monoisotopic Mass | 380.10421 |
| SMILES | CCOC(=O)c1sc(NN=C2C(=O)CCCC2=O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C17H20N2O6S/c1-4-24-16(22)12-9(3)14(17(23)25-5-2)26-15(12)19-18-13-10(20)7-6-8-11(13)21/h19H,4-8H2,1-3H3 |
| InChIKey | LGSVJSPEAHMKHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[2-(2,6-dioxocyclohexylidene)hydrazinyl]-3-methylthiophene-2,4-dicarboxylic acid diethyl ester (CHEBI:112441) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23853 | LINCS |