EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N2 |
| Net Charge | 0 |
| Average Mass | 284.362 |
| Monoisotopic Mass | 284.13135 |
| SMILES | C(=Cc1cc(C=Cc2ccccc2)ncn1)c1ccccc1 |
| InChI | InChI=1S/C20H16N2/c1-3-7-17(8-4-1)11-13-19-15-20(22-16-21-19)14-12-18-9-5-2-6-10-18/h1-16H |
| InChIKey | VIWSLCCWPMJBQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6-bis(2-phenylethenyl)pyrimidine (CHEBI:112395) is a diarylheptanoid (CHEBI:78802) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23807 | LINCS |