EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13ClN2O4 |
| Net Charge | 0 |
| Average Mass | 332.743 |
| Monoisotopic Mass | 332.05638 |
| SMILES | CC(=NNc1ccc(Cl)c(C(=O)O)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13ClN2O4/c1-9(10-2-5-14-15(6-10)23-8-22-14)18-19-11-3-4-13(17)12(7-11)16(20)21/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | IHSBQUNDZINXHS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-2-chlorobenzoic acid (CHEBI:112374) is a benzoic acids (CHEBI:22723) |
| 5-[2-[1-(1,3-benzodioxol-5-yl)ethylidene]hydrazinyl]-2-chlorobenzoic acid (CHEBI:112374) is a organohalogen compound (CHEBI:17792) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23786 | LINCS |