EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClN4O4S2 |
| Net Charge | 0 |
| Average Mass | 507.037 |
| Monoisotopic Mass | 506.08492 |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2ccc(Cn3cc(Cl)cn3)o2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C22H23ClN4O4S2/c1-3-30-21(29)18-15-6-4-12(2)8-17(15)33-20(18)26-22(32)25-19(28)16-7-5-14(31-16)11-27-10-13(23)9-24-27/h5,7,9-10,12H,3-4,6,8,11H2,1-2H3,(H2,25,26,28,32) |
| InChIKey | UBMMPWIYJFDHNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[[[[5-[(4-chloro-1-pyrazolyl)methyl]-2-furanyl]-oxomethyl]amino]-sulfanylidenemethyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid ethyl ester (CHEBI:112370) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23782 | LINCS |