EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31N5O6 |
| Net Charge | 0 |
| Average Mass | 557.607 |
| Monoisotopic Mass | 557.22743 |
| SMILES | COc1ccc(-n2nc(C(=O)NCC(=O)N3CCN(c4ccccc4OC)CC3)c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C30H31N5O6/c1-39-20-12-13-24(26(18-20)41-3)35-30(38)22-9-5-4-8-21(22)28(32-35)29(37)31-19-27(36)34-16-14-33(15-17-34)23-10-6-7-11-25(23)40-2/h4-13,18H,14-17,19H2,1-3H3,(H,31,37) |
| InChIKey | ONFHAGVOCAIGTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2,4-dimethoxyphenyl)-N-[2-[4-(2-methoxyphenyl)-1-piperazinyl]-2-oxoethyl]-4-oxo-1-phthalazinecarboxamide (CHEBI:112359) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23771 | LINCS |