EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO4S |
| Net Charge | 0 |
| Average Mass | 295.360 |
| Monoisotopic Mass | 295.08783 |
| SMILES | COc1cc(SC)ccc1C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H17NO4S/c1-18-12-7-10(20-2)5-6-11(12)14(17)19-8-13(16)15-9-3-4-9/h5-7,9H,3-4,8H2,1-2H3,(H,15,16) |
| InChIKey | RBOVDKHZWMXSQO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-4-(methylthio)benzoic acid [2-(cyclopropylamino)-2-oxoethyl] ester (CHEBI:112263) is a methoxybenzoic acid (CHEBI:25238) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23675 | LINCS |