EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10F3N3O2 |
| Net Charge | 0 |
| Average Mass | 273.214 |
| Monoisotopic Mass | 273.07251 |
| SMILES | CC1=C(C#N)C(NC(=O)C2CC2)(C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C11H10F3N3O2/c1-5-7(4-15)10(9(19)16-5,11(12,13)14)17-8(18)6-2-3-6/h6H,2-3H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | BPAVCFHQKIHUDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-cyano-5-methyl-2-oxo-3-(trifluoromethyl)-1H-pyrrol-3-yl]cyclopropanecarboxamide (CHEBI:112230) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23642 | LINCS |