EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5ClO3 |
| Net Charge | 0 |
| Average Mass | 148.545 |
| Monoisotopic Mass | 147.99272 |
| SMILES | C=C/C(Cl)=C(/O)C(=O)O |
| InChI | InChI=1S/C5H5ClO3/c1-2-3(6)4(7)5(8)9/h2,7H,1H2,(H,8,9)/b4-3- |
| InChIKey | XZOBUTBZRFDQBU-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Hydroxy-3-chloropenta-2,4-dienoate (CHEBI:1121) is a halo fatty acid (CHEBI:60692) |
| Synonym | Source |
|---|---|
| 2-Hydroxy-3-chloropenta-2,4-dienoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11353 | KEGG COMPOUND |