EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3O2 |
| Net Charge | 0 |
| Average Mass | 243.266 |
| Monoisotopic Mass | 243.10078 |
| SMILES | [H][C@@]1([C@H](C)c2cnc3ccccc23)OC(N)=NC1=O |
| InChI | InChI=1S/C13H13N3O2/c1-7(11-12(17)16-13(14)18-11)9-6-15-10-5-3-2-4-8(9)10/h2-7,11,15H,1H3,(H2,14,16,17)/t7-,11+/m1/s1 |
| InChIKey | JMQXZRUQJGJVSC-HQJQHLMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseus (ncbitaxon:1911) | - | PubMed (25730866) | Strain: ATCC 12648 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-demethylindolmycin (CHEBI:111763) has role bacterial metabolite (CHEBI:76969) |
| N-demethylindolmycin (CHEBI:111763) is a 1,3-oxazoles (CHEBI:46812) |
| N-demethylindolmycin (CHEBI:111763) is a indoles (CHEBI:24828) |
| N-demethylindolmycin (CHEBI:111763) is a primary amino compound (CHEBI:50994) |
| N-demethylindolmycin (CHEBI:111763) is conjugate base of N-demethylindolmycin(1+) (CHEBI:91178) |
| Incoming Relation(s) |
| N-demethylindolmycin(1+) (CHEBI:91178) is conjugate acid of N-demethylindolmycin (CHEBI:111763) |
| IUPAC Name |
|---|
| (5S)-2-amino-5-[(1R)-1-(1H-indol-3-yl)ethyl]-1,3-oxazol-4(5H)-one |
| Manual Xrefs | Databases |
|---|---|
| CPD-18933 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8988159 | Reaxys |
| Citations |
|---|