EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N4O6 |
| Net Charge | 0 |
| Average Mass | 526.634 |
| Monoisotopic Mass | 526.27913 |
| SMILES | CC(C)NC(=O)Nc1ccc2c(c1)C(=O)N([C@@H](C)CO)C[C@H](C)[C@@H](CN(C)Cc1ccc(C(=O)O)cc1)O2 |
| InChI | InChI=1S/C28H38N4O6/c1-17(2)29-28(37)30-22-10-11-24-23(12-22)26(34)32(19(4)16-33)13-18(3)25(38-24)15-31(5)14-20-6-8-21(9-7-20)27(35)36/h6-12,17-19,25,33H,13-16H2,1-5H3,(H,35,36)(H2,29,30,37)/t18-,19-,25+/m0/s1 |
| InChIKey | IVCWXLSTMUVHLA-XHNVNVPESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[[(2S,3S)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-8-[[oxo-(propan-2-ylamino)methyl]amino]-3,4-dihydro-2H-1,5-benzoxazocin-2-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:111619) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-23033 | LINCS |