EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O11 |
| Net Charge | 0 |
| Average Mass | 420.371 |
| Monoisotopic Mass | 420.13801 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H24N2O11/c19-3-8-7(21)1-10(28-8)18-2-6(14(25)17-16(18)26)5-27-15-13(24)12(23)11(22)9(4-20)29-15/h2,7-13,15,19-24H,1,3-5H2,(H,17,25,26)/t7-,8+,9+,10+,11+,12-,13+,15+/m0/s1 |
| InChIKey | LHASLBSEALHFGO-URARBOGNSA-N |
| Roles Classification |
|---|
| Biological Role: | eukaryotic metabolite Any metabolite produced during a metabolic reaction in eukaryotes, the taxon that include members of the fungi, plantae and animalia kingdoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (β-D-glucopyranosyloxymethyl)deoxyuridine (CHEBI:111513) has functional parent 5-hydroxymethyluracil (CHEBI:16964) |
| (β-D-glucopyranosyloxymethyl)deoxyuridine (CHEBI:111513) has role eukaryotic metabolite (CHEBI:75763) |
| (β-D-glucopyranosyloxymethyl)deoxyuridine (CHEBI:111513) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| (β-D-glucopyranosyloxymethyl)deoxyuridine (CHEBI:111513) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| (β-D-glucopyranosyloxymethyl)deoxyuridine residue (CHEBI:111516) is substituent group from (β-D-glucopyranosyloxymethyl)deoxyuridine (CHEBI:111513) |
| IUPAC Name |
|---|
| 2'-deoxy-5-[(β-D-glucopyranosyloxy)methyl]uridine |
| Synonyms | Source |
|---|---|
| 5-((Glucopyranosyloxy)methyl)uridine | ChemIDplus |
| 5-(β-D-glucopyranosyloxymethyl)-2'-deoxyuridine | ChEBI |
| alpha-(beta-D-Glucopyranosyloxy)thymidine | ChemIDplus |
| beta-Ghmu | ChemIDplus |
| dJ | ChEBI |
| β-D-glucosyl-HOMedU | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6830477 | Reaxys |
| CAS:53910-96-6 | ChemIDplus |
| Citations |
|---|