EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13BrN2O2 |
| Net Charge | 0 |
| Average Mass | 333.185 |
| Monoisotopic Mass | 332.01604 |
| SMILES | Cc1ccc(C(=O)ON=C(N)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C15H13BrN2O2/c1-10-2-4-12(5-3-10)15(19)20-18-14(17)11-6-8-13(16)9-7-11/h2-9H,1H3,(H2,17,18) |
| InChIKey | UISPMHKDFGTWKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylbenzoic acid [[amino-(4-bromophenyl)methylidene]amino] ester (CHEBI:111467) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-22923 | LINCS |