EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N3O5 |
| Net Charge | 0 |
| Average Mass | 381.388 |
| Monoisotopic Mass | 381.13247 |
| SMILES | COc1ccccc1C=CC(=O)NCC(=O)NN=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19N3O5/c1-26-16-5-3-2-4-15(16)7-9-19(24)21-12-20(25)23-22-11-14-6-8-17-18(10-14)28-13-27-17/h2-11H,12-13H2,1H3,(H,21,24)(H,23,25) |
| InChIKey | BPVZHVGNNDFMGB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-3-(2-methoxyphenyl)-2-propenamide (CHEBI:111386) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-22842 | LINCS |