EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N3O2 |
| Net Charge | 0 |
| Average Mass | 329.444 |
| Monoisotopic Mass | 329.21033 |
| SMILES | O=C(NCc1ccccc1)NC1(C(=O)N2CCCC2)CCCCC1 |
| InChI | InChI=1S/C19H27N3O2/c23-17(22-13-7-8-14-22)19(11-5-2-6-12-19)21-18(24)20-15-16-9-3-1-4-10-16/h1,3-4,9-10H,2,5-8,11-15H2,(H2,20,21,24) |
| InChIKey | MAOPJHOUQJUPDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[1-[oxo(1-pyrrolidinyl)methyl]cyclohexyl]-3-(phenylmethyl)urea (CHEBI:111346) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-22802 | LINCS |