EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO6 |
| Net Charge | 0 |
| Average Mass | 329.308 |
| Monoisotopic Mass | 329.08994 |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H15NO6/c1-22-15(19)11-8-9-13(16(20)23-2)14(10-11)18-17(21)24-12-6-4-3-5-7-12/h3-10H,1-2H3,(H,18,21) |
| InChIKey | JYLOVBIKEYPSER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[oxo(phenoxy)methyl]amino]benzene-1,4-dicarboxylic acid dimethyl ester (CHEBI:111245) is a phthalate ester (CHEBI:35484) |
| Manual Xrefs | Databases |
|---|---|
| LSM-22701 | LINCS |