EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO5 |
| Net Charge | 0 |
| Average Mass | 305.330 |
| Monoisotopic Mass | 305.12632 |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C16H19NO5/c1-22-16(21)12-8-4-5-9-13(12)17-14(18)10-6-2-3-7-11(10)15(19)20/h4-5,8-11H,2-3,6-7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | DEAVWQSRBJQFEW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(2-methoxycarbonylanilino)-oxomethyl]-1-cyclohexanecarboxylic acid (CHEBI:111239) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-22695 | LINCS |