EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O |
| Net Charge | 0 |
| Average Mass | 190.246 |
| Monoisotopic Mass | 190.11061 |
| SMILES | O=c1cccc2n1CC1CNCC2C1 |
| InChI | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2 |
| InChIKey | ANJTVLIZGCUXLD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-22634 (CHEBI:111178) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| LSM-22634 | LINCS |