EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4Cl2O6P2 |
| Net Charge | 0 |
| Average Mass | 244.891 |
| Monoisotopic Mass | 243.88602 |
| SMILES | O=P(O)(O)C(Cl)(Cl)P(=O)(O)O |
| InChI | InChI=1S/CH4Cl2O6P2/c2-1(3,10(4,5)6)11(7,8)9/h(H2,4,5,6)(H2,7,8,9) |
| InChIKey | ACSIXWWBWUQEHA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clodronic acid (CHEBI:110423) has role antineoplastic agent (CHEBI:35610) |
| clodronic acid (CHEBI:110423) has role bone density conservation agent (CHEBI:50646) |
| clodronic acid (CHEBI:110423) is a 1,1-bis(phosphonic acid) (CHEBI:77383) |
| clodronic acid (CHEBI:110423) is a one-carbon compound (CHEBI:64708) |
| clodronic acid (CHEBI:110423) is a organochlorine compound (CHEBI:36683) |
| clodronic acid (CHEBI:110423) is conjugate acid of clondronate(2−) (CHEBI:59585) |
| Incoming Relation(s) |
| clondronate(2−) (CHEBI:59585) is conjugate base of clodronic acid (CHEBI:110423) |
| IUPAC Name |
|---|
| (dichloromethanediyl)bis(phosphonic acid) |
| INNs | Source |
|---|---|
| acide clodronique | ChemIDplus |
| acido clodronico | ChemIDplus |
| acidum clodronicum | ChemIDplus |
| clodronic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| clodronate | ChemIDplus |
| clodronsaeure | ChemIDplus |
| dichloromethylene-1,1-bisphosphonic acid | ChEBI |
| dichloromethylene-1,1-diphosphonic acid | ChEBI |
| (dichloromethylene)bisphosphonic acid | ChEBI |
| (dichloromethylene)diphosphonic acid | ChEBI |
| Citations |
|---|