EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5 |
| Net Charge | -2 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02262 |
| SMILES | C[C@](O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H8O5/c1-5(10,4(8)9)2-3(6)7/h10H,2H2,1H3,(H,6,7)(H,8,9)/p-2/t5-/m0/s1 |
| InChIKey | XFTRTWQBIOMVPK-YFKPBYRVSA-L |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-citramalate(2−) (CHEBI:30936) is a citramalate(2−) (CHEBI:13997) |
| L-citramalate(2−) (CHEBI:30936) is conjugate base of L-citramalic acid (CHEBI:29003) |
| Incoming Relation(s) |
| L-citramalic acid (CHEBI:29003) is conjugate acid of L-citramalate(2−) (CHEBI:30936) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-2-methylbutanedioate |
| Synonyms | Source |
|---|---|
| (2S)-2-hydroxy-2-methylsuccinate | ChEBI |
| (3S)-Citramalate | KEGG COMPOUND |
| L-Citramalate | KEGG COMPOUND |
| (S)-2-Methylmalate | KEGG COMPOUND |
| (S)-citramalate | ChEBI |
| S-Citramalate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (3S)-citramalate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02614 | KEGG COMPOUND |
| S-CITRAMALATE | MetaCyc |