EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22Cl2O3 |
| Net Charge | 0 |
| Average Mass | 333.255 |
| Monoisotopic Mass | 332.09460 |
| SMILES | CCCCCCC(C)OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2O3/c1-3-4-5-6-7-12(2)21-16(19)11-20-15-9-8-13(17)10-14(15)18/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | GJNVTNDAZUATRV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2,4-dichlorophenoxy)acetic acid octan-2-yl ester (CHEBI:110166) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| LSM-21595 | LINCS |