EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N3O8S |
| Net Charge | 0 |
| Average Mass | 379.391 |
| Monoisotopic Mass | 379.10494 |
| SMILES | C[C@@H](O)C(=O)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H21N3O8S/c1-6(17)13(24)25-5-8(11(21)15-4-10(19)20)16-9(18)3-2-7(14)12(22)23/h6-8,17H,2-5,14H2,1H3,(H,15,21)(H,16,18)(H,19,20)(H,22,23)/t6-,7+,8+/m1/s1 |
| InChIKey | VDYDCVUWILIYQF-CSMHCCOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-S-lactoylglutathione (CHEBI:15694) has functional parent (R)-lactic acid (CHEBI:42111) |
| (R)-S-lactoylglutathione (CHEBI:15694) has role Escherichia coli metabolite (CHEBI:76971) |
| (R)-S-lactoylglutathione (CHEBI:15694) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (R)-S-lactoylglutathione (CHEBI:15694) has role human metabolite (CHEBI:77746) |
| (R)-S-lactoylglutathione (CHEBI:15694) has role mouse metabolite (CHEBI:75771) |
| (R)-S-lactoylglutathione (CHEBI:15694) is a glutathione derivative (CHEBI:24337) |
| (R)-S-lactoylglutathione (CHEBI:15694) is conjugate acid of (R)-S-lactoylglutathionate(1−) (CHEBI:57474) |
| Incoming Relation(s) |
| (R)-S-lactoylglutathionate(1−) (CHEBI:57474) is conjugate base of (R)-S-lactoylglutathione (CHEBI:15694) |
| IUPAC Name |
|---|
| S-[(2R)-2-hydroxypropanoyl]-γ-L-glutamyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| S-lactoylglutathione | ChemIDplus |
| (R)-S-Lactoylglutathione | KEGG COMPOUND |
| S-D-Lactoylglutathione | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00019550 | KNApSAcK |
| C03451 | KEGG COMPOUND |
| C03451 | KEGG COMPOUND |
| HMDB0001066 | HMDB |
| S-LACTOYL-GLUTATHIONE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1717478 | Reaxys |
| CAS:25138-66-3 | ChemIDplus |
| Citations |
|---|