EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N7O18P3S |
| Net Charge | 0 |
| Average Mass | 915.702 |
| Monoisotopic Mass | 915.16764 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C30H44N7O18P3S/c1-30(2,24(41)27(42)33-9-8-20(39)32-10-11-59-29(43)18(38)12-17-6-4-3-5-7-17)14-52-58(49,50)55-57(47,48)51-13-19-23(54-56(44,45)46)22(40)28(53-19)37-16-36-21-25(31)34-15-35-26(21)37/h3-7,15-16,18-19,22-24,28,38,40-41H,8-14H2,1-2H3,(H,32,39)(H,33,42)(H,47,48)(H,49,50)(H2,31,34,35)(H2,44,45,46)/t18-,19-,22-,23-,24+,28-/m1/s1 |
| InChIKey | FKMUDVUPQINOSF-NHZRKUKBSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-phenyllactoyl-CoA (CHEBI:11010) has functional parent coenzyme A (CHEBI:15346) |
| (R)-phenyllactoyl-CoA (CHEBI:11010) is a acyl-CoA (CHEBI:17984) |
| (R)-phenyllactoyl-CoA (CHEBI:11010) is conjugate acid of (R)-phenyllactoyl-CoA(4−) (CHEBI:57254) |
| Incoming Relation(s) |
| (R)-phenyllactoyl-CoA(4−) (CHEBI:57254) is conjugate base of (R)-phenyllactoyl-CoA (CHEBI:11010) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(2R)-2-hydroxy-3-phenylpropanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (R)-3-phenyllactyl-CoA | ChEBI |
| (R)-3-phenyllactyl-coenzyme A | ChEBI |
| (R)-phenyllactoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16257 | KEGG COMPOUND |