EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2 |
| Net Charge | 0 |
| Average Mass | 282.431 |
| Monoisotopic Mass | 282.20960 |
| SMILES | CC[C@@]12CCC[N@](CCc3c(nc4ccccc34)CC1)C2 |
| InChI | InChI=1S/C19H26N2/c1-2-19-10-5-12-21(14-19)13-9-16-15-6-3-4-7-17(15)20-18(16)8-11-19/h3-4,6-7,20H,2,5,8-14H2,1H3/t19-/m1/s1 |
| InChIKey | FDNDLNFGITWTOZ-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-Quebrachamine (CHEBI:110) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| (-)-Quebrachamine | KEGG COMPOUND |
| Quebrachamine | KEGG COMPOUND |