EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H38N2O6 |
| Net Charge | 0 |
| Average Mass | 594.708 |
| Monoisotopic Mass | 594.27299 |
| SMILES | [H][C@]12Cc3ccc(cc3)Oc3c(O)c(OC)cc4c3[C@]([H])(Cc3ccc(O)c(c3)Oc3cc1c(cc3OC)CCN2C)N(C)CC4 |
| InChI | InChI=1S/C36H38N2O6/c1-37-13-11-23-18-31(41-3)32-20-26(23)27(37)15-21-5-8-25(9-6-21)43-36-34-24(19-33(42-4)35(36)40)12-14-38(2)28(34)16-22-7-10-29(39)30(17-22)44-32/h5-10,17-20,27-28,39-40H,11-16H2,1-4H3/t27-,28-/m0/s1 |
| InChIKey | NGZXDRGWBULKFA-NSOVKSMOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-Bebeerine (CHEBI:11) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| (+)-Bebeerine (CHEBI:11) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| (+)-Bebeerine | KEGG COMPOUND |
| Bebeerine | KEGG COMPOUND |