EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N3O2S |
| Net Charge | 0 |
| Average Mass | 255.343 |
| Monoisotopic Mass | 255.10415 |
| SMILES | CCCCSc1ncc(C(=O)OCC)c(N)n1 |
| InChI | InChI=1S/C11H17N3O2S/c1-3-5-6-17-11-13-7-8(9(12)14-11)10(15)16-4-2/h7H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | ZGIWBBOWHHBPTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-2-(butylthio)-5-pyrimidinecarboxylic acid ethyl ester (CHEBI:109827) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| Manual Xrefs | Databases |
|---|---|
| LSM-21255 | LINCS |