EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O4 |
| Net Charge | 0 |
| Average Mass | 272.260 |
| Monoisotopic Mass | 272.07971 |
| SMILES | COC1=CC(=NNc2ccccc2C(=O)O)C=CC1=O |
| InChI | InChI=1S/C14H12N2O4/c1-20-13-8-9(6-7-12(13)17)15-16-11-5-3-2-4-10(11)14(18)19/h2-8,16H,1H3,(H,18,19) |
| InChIKey | QPIZUBPCFNAEPF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[2-(3-methoxy-4-oxo-1-cyclohexa-2,5-dienylidene)hydrazinyl]benzoic acid (CHEBI:109781) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-21209 | LINCS |