EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10Cl2N2O4S |
| Net Charge | 0 |
| Average Mass | 349.195 |
| Monoisotopic Mass | 347.97383 |
| SMILES | CC(OC(=O)c1nsc(Cl)c1Cl)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H10Cl2N2O4S/c1-6(11(17)15-5-7-3-2-4-19-7)20-12(18)9-8(13)10(14)21-16-9/h2-4,6H,5H2,1H3,(H,15,17) |
| InChIKey | XWFUUIKRNQMEEN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dichloro-3-isothiazolecarboxylic acid [1-(2-furanylmethylamino)-1-oxopropan-2-yl] ester (CHEBI:109607) is a aromatic carboxylic acid (CHEBI:33859) |
| 4,5-dichloro-3-isothiazolecarboxylic acid [1-(2-furanylmethylamino)-1-oxopropan-2-yl] ester (CHEBI:109607) is a thiazoles (CHEBI:48901) |
| Manual Xrefs | Databases |
|---|---|
| LSM-21035 | LINCS |