EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N7O17P3S |
| Net Charge | 0 |
| Average Mass | 897.687 |
| Monoisotopic Mass | 897.15707 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H42N7O17P3S/c1-30(2,25(41)28(42)33-11-10-20(38)32-12-13-58-21(39)9-8-18-6-4-3-5-7-18)15-51-57(48,49)54-56(46,47)50-14-19-24(53-55(43,44)45)23(40)29(52-19)37-17-36-22-26(31)34-16-35-27(22)37/h3-9,16-17,19,23-25,29,40-41H,10-15H2,1-2H3,(H,32,38)(H,33,42)(H,46,47)(H,48,49)(H2,31,34,35)(H2,43,44,45)/b9-8+/t19-,23-,24-,25+,29-/m1/s1 |
| InChIKey | JVNVHNHITFVWIX-KZKUDURGSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-cinnamoyl-CoA (CHEBI:10956) is a cinnamoyl-CoA (CHEBI:15463) |
| (E)-cinnamoyl-CoA (CHEBI:10956) is conjugate acid of (E)-cinnamoyl-CoA(4−) (CHEBI:57252) |
| Incoming Relation(s) |
| (E)-cinnamoyl-CoA(4−) (CHEBI:57252) is conjugate base of (E)-cinnamoyl-CoA (CHEBI:10956) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-({3-oxo-3-[(2-{[(2E)-3-phenylprop-2-enoyl]sulfanyl}ethyl)amino]propyl}amino)butyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| Cinnamoyl-coenzyme A | ChemIDplus |
| Coenzyme A, S-(3-phenyl-2-propenoate), (E)- | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C16256 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:76109-04-1 | ChemIDplus |
| CAS:76109-04-1 | KEGG COMPOUND |