EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO2 |
| Net Charge | 0 |
| Average Mass | 259.349 |
| Monoisotopic Mass | 259.15723 |
| SMILES | CCC(=O)NCC[C@@H]1CCc2ccc3c(c21)CCO3 |
| InChI | InChI=1S/C16H21NO2/c1-2-15(18)17-9-7-12-4-3-11-5-6-14-13(16(11)12)8-10-19-14/h5-6,12H,2-4,7-10H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | YLXDSYKOBKBWJQ-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e]benzofuran-8-yl]ethyl]propanamide (CHEBI:109549) has role antidepressant (CHEBI:35469) |
| N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e]benzofuran-8-yl]ethyl]propanamide (CHEBI:109549) has role antipsychotic agent (CHEBI:35476) |
| N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e]benzofuran-8-yl]ethyl]propanamide (CHEBI:109549) has role antiviral agent (CHEBI:22587) |
| N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e]benzofuran-8-yl]ethyl]propanamide (CHEBI:109549) is a indanes (CHEBI:46940) |
| Synonyms | Source |
|---|---|
| ramelteon | ChEMBL |
| Ramelteon | ChEMBL |
| rozerem | DrugCentral |
| TAK-375 | DrugCentral |
| TAK375 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2355 | DrugCentral |
| HMDB0015115 | HMDB |
| LSM-20965 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:196597-26-9 | DrugCentral |
| Citations |
|---|