EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5Br2NO |
| Net Charge | 0 |
| Average Mass | 302.953 |
| Monoisotopic Mass | 300.87379 |
| SMILES | Oc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C9H5Br2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | ZDASUJMDVPTNTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7-dibromo-8-quinolinol (CHEBI:109543) has role antiamoebic agent (CHEBI:171664) |
| 5,7-dibromo-8-quinolinol (CHEBI:109543) is a organohalogen compound (CHEBI:17792) |
| 5,7-dibromo-8-quinolinol (CHEBI:109543) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| broxiquinolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| broxyquinolin | DrugCentral |
| broxyquinoline | ChEMBL |
| Broxyquinoline | ChEMBL |
| dibromoquin | DrugCentral |
| dibromoxin | DrugCentral |
| dibromoxine | DrugCentral |
| Citations |
|---|