EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H4Cl2O2 |
| Net Charge | 0 |
| Average Mass | 215.035 |
| Monoisotopic Mass | 213.95883 |
| SMILES | O=c1oc(Cl)c(Cl)c2ccccc12 |
| InChI | InChI=1S/C9H4Cl2O2/c10-7-5-3-1-2-4-6(5)9(12)13-8(7)11/h1-4H |
| InChIKey | SUGXUUGGLDCZKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dichloroisocoumarin (CHEBI:109540) has role geroprotector (CHEBI:176497) |
| 3,4-dichloroisocoumarin (CHEBI:109540) has role serine protease inhibitor (CHEBI:64926) |
| 3,4-dichloroisocoumarin (CHEBI:109540) is a isocoumarins (CHEBI:38758) |
| 3,4-dichloroisocoumarin (CHEBI:109540) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 3,4-dichloro-1H-isochromen-1-one |
| Synonyms | Source |
|---|---|
| 3,4-DCI | ChEBI |
| 3,4-dichloro-1H-2-benzopyran-1-one | IUPAC |
| 3,4-dichloro-2-benzopyran-1-one | ChEBI |
| 3,4-dichloroisochromen-1-one | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:51050-59-0 | ChemIDplus |
| Citations |
|---|